|
Cat # |
Product |
Qty |
Price |
|
|
|
|
|
|
LF-MA0001 |
Anti-Peroxiredoxin Ⅴ (4C3) |
100 ㎕ |
284 |
|
LF-MA0002 |
Anti-Peroxiredoxin Ⅴ (3F11) |
100 ㎕ |
284 |
|
LF-MA0003 |
Anti-Catalase (1A1) |
100 ㎕ |
284 |
|
LF-MA0004 |
Anti-Catalase (2A1) |
100 ㎕ |
284 |
|
LF-MA0005 |
Anti-Peroxiredoxin Ⅳ(1A1) |
100 ㎕ |
320 |
|
LF-MA0006 |
Anti-Peroxiredoxin Ⅳ (3A1) |
100 ㎕ |
320 |
|
LF-MA0010 |
Anti-Catalase (11A1) |
100 ㎕ |
284 |
|
LF-MA0013 |
Anti-Peroxiredoxin Ⅵ (1A11) |
100 ㎕ |
320 |
|
LF-MA0014 |
Anti-Peroxiredoxin Ⅳ (7A1) |
100 ㎕ |
320 |
|
LF-MA0015 |
Anti-Thioredoxin Reductase 1 (19A1) |
100 ㎕ |
320 |
|
LF-MA0016 |
Anti-Superoxide Dismutase 4 (2A1) |
100 ㎕ |
320 |
|
LF-MA0017 |
Anti-Peroxiredoxin Ⅴ (12A) |
100 ㎕ |
284 |
|
LF-MA0018 |
Anti-Peroxiredoxin Ⅵ (4A3) |
100 ㎕ |
320 |
|
LF-MA0019 |
Anti-Superoxide Dismutase 4 (11G1) |
100 ㎕ |
320 |
|
LF-MA0020 |
Anti-Thioredoxin Reductase 1 (5A5) |
100 ㎕ |
320 |
|
LF-MA0023 |
Anti-Superoxide Dismutase 1 (72B1) |
100 ㎕ |
284 |
|
LF-MA0024 |
Anti-Glutathione Reductase (2B3) |
100 ㎕ |
320 |
|
LF-MA0025 |
Anti-Thioredoxin Reductase 2 (7B2) |
100 ㎕ |
320 |
|
LF-MA0026 |
Anti-Glyceraldehyde-3-Phosphate Dehydrogenase (GAPDH) (8C2) |
100 ㎕ |
284 |
|
LF-MA0029 |
Anti-Superoxide Dismutase 1 (8A1) |
100 ㎕ |
284 |
|
LF-MA0030 |
Anti-Superoxide Dismutase 2 (2A1) |
100 ㎕ |
284 |
|
LF-MA0031 |
Anti-Peroxiredoxin Ⅰ (9D2) |
100 ㎕ |
320 |
|
LF-MA0033 |
Anti-Ferredoxin Reductase (6C2) |
100 ㎕ |
320 |
|
LF-MA0035 |
Anti-Superoxide Dismutase 2 (1E8) |
100 ㎕ |
284 |
|
LF-MA0036 |
Anti-Glutathione Reductase (1A7) |
100 ㎕ |
320 |
|
LF-MA0038 |
Anti-Glyceraldehyde-3-Phosphate Dehydrogenase (GAPDH) (7B) |
100 ㎕ |
284 |
|
LF-MA0042 |
Anti-Superoxide Dismutase 4 (3A1) |
100 ㎕ |
320 |
|
LF-MA0043 |
Anti-Peroxiredoxin Ⅲ (2B11) |
100 ㎕ |
320 |
|
LF-MA0044 |
Anti-Peroxiredoxin Ⅲ (12B) |
100 ㎕ |
320 |
|
LF-MA0045 |
Anti-Peroxiredoxin Ⅲ (4G10) |
100 ㎕ |
320 |
|
LF-MA0047 |
Anti-Amphiphysin (N8-2) |
100 ㎕ |
284 |
|
LF-MA0049 |
Anti-Phospholipase C γ (1F1) |
100 ㎕ |
284 |
|
LF-MA0050 |
Anti-Phospholipase C γ (2B1) |
100 ㎕ |
284 |
|
LF-MA0051 |
Anti-Protein Tyrosine phosphatase 1B (PTP1B;3A7) |
100 ㎕ |
284 |
|
LF-MA0052 |
Anti-GST tag (LF4G2) |
100 ㎕ |
284 |
|
LF-MA0053 |
Anti-S100β (SB6) |
100 ㎕ |
284 |
|
LF-MA0054 |
Anti-Thioredoxin Reductase 2 (25B3) |
100 ㎕ |
320 |
|
LF-MA0055 |
Anti-Thioredoxin 1 (3A1) |
100 ㎕ |
284 |
|
LF-MA0057 |
Anti-Selenoprotein M (4C2) |
100 ㎕ |
320 |
|
LF-MA0058 |
Anti-Selenoprotein M (10C1) |
100 ㎕ |
320 |
|
LF-MA0059 |
Anti-Glutathione Peroxidase 4 (7A4) |
100 ㎕ |
320 |
|
LF-MA0062 |
Anti-S100β (SB14) |
100 ㎕ |
284 |
|
LF-MA0063 |
Anti-Amphiphysin (C14-23) |
100 ㎕ |
284 |
|
LF-MA0064 |
Anti-gamma Enolase (37E4) |
100 ㎕ |
284 |
|
LF-MA0065 |
Anti-Superoxide Dismutase 2 (4F10) |
100 ㎕ |
284 |
|
LF-MA0066 |
Anti-Superoxide Dismutase 2 (23G5) |
100 ㎕ |
284 |
|
LF-MA0067 |
Anti-Peroxiredoxin Ⅵ (5E1) |
100 ㎕ |
320 |
|
LF-MA0068 |
Anti-Peroxiredoxin Ⅰ (2A4) |
100 ㎕ |
320 |
|
LF-MA0069 |
Anti-Peroxiredoxin Ⅰ (13E7) |
100 ㎕ |
320 |
|
LF-MA0070 |
Anti-Peroxiredoxin Ⅱ (9A1) |
100 ㎕ |
320 |
|
LF-MA0071 |
Anti-Peroxiredoxin Ⅱ (12B1) |
100 ㎕ |
320 |
|
LF-MA0072 |
Anti-Glutaredoxin 1 (28C3) |
100 ㎕ |
320 |
|
LF-MA0073 |
Anti-2-Cys Peroxiredoxin (6E5) |
100 ㎕ |
320 |
|
LF-MA0074 |
Anti-14-3-3 β (60C10) |
100 ㎕ |
284 |
|
LF-MA0075 |
Anti-gamma Enolase (85F11) |
100 ㎕ |
284 |
|
LF-MA0076 |
Anti-Diazepam Binding Inhibitor (20B10) |
100 ㎕ |
320 |
|
LF-MA0077 |
Anti-Thioredoxin 1 (8A1) |
100 ㎕ |
284 |
|
LF-MA0078 |
Anti-Catecholamine-Sulfating Phenol Sulfotransferase (3F10) |
100 ㎕ |
320 |
|
LF-MA0079 |
Anti-Thioredoxin 2 (4C5) |
100 ㎕ |
320 |
|
LF-MA0080 |
Anti-Thioredoxin 2 (71G4) |
100 ㎕ |
320 |
|
LF-MA0081 |
Anti-Diazepam Binding Inhibitor (27C9) |
100 ㎕ |
320 |
|
LF-MA0082 |
Anti-Glutaredoxin 1 (30A1) |
100 ㎕ |
320 |
|
LF-MA0083 |
Anti-Methionine Sulfoxide Reductase A (1C8) |
100 ㎕ |
284 |
|
LF-MA0084 |
Anti-Methionine Sulfoxide Reductase A (5B5) |
100 ㎕ |
284 |
|
LF-MA0085 |
Anti-Glutathione Peroxidase 4 (1H11) |
100 ㎕ |
320 |
|
LF-MA0087 |
Anti-Ubiquitin+1 (40B3) |
100 ㎕ |
284 |
|
LF-MA0088 |
Anti-Peroxiredoxin-SO3 (10A1) |
100 ㎕ |
475 |
|
LF-MA0090 |
Anti-Glutathione Peroxidase 1 (2A10) |
100 ㎕ |
284 |
|
LF-MA0091 |
Anti-Glutathione Peroxidase 1 (42C9) |
100 ㎕ |
284 |
|
LF-MA0093 |
Anti-Transglutaminase 2 (2A1) |
100 ㎕ |
284 |
|
LF-MA0094 |
Anti-Transglutaminase 2 (14G2) |
100 ㎕ |
284 |
|
LF-MA0095 |
Anti-Glutamine Synthetase (8G9) |
100 ㎕ |
284 |
|
LF-MA0096 |
Anti-Glutamine Synthetase (27D10) |
100 ㎕ |
284 |
|
LF-MA0097 |
Anti-gamma Enolase (18H2) |
100 ㎕ |
284 |
|
LF-MA0099 |
Anti-Paraoxonase 1 (17A12) |
100 ㎕ |
320 |
|
LF-MA0100 |
Anti-Glyceraldehyde-3-Phosphate Dehydrogenase (GAPDH)-SO3 (4A1) |
100 ㎕ |
475 |
|
LF-MA0101 |
Anti-Heat Shock Protein 70 (16A12) |
100 ㎕ |
284 |
|
LF-MA0102 |
Anti-beta catenin (1C10) |
100 ㎕ |
284 |
|
LF-MA0103 |
Anti-beta catenin (1F12) |
100 ㎕ |
284 |
|
LF-MA0104 |
Anti-Peroxiredoxin Ⅵ (6H5) |
100 ㎕ |
320 |
|
LF-MA0106 |
Anti-Human Serum Albumin (1G2) |
100 ㎕ |
284 |
|
LF-MA0107 |
Anti-AntiThrombin 3 (8C12) |
100 ㎕ |
284 |
|
LF-MA0108 |
Anti-Fibrinogen(5C5) |
100 ㎕ |
284 |
|
LF-MA0109 |
Anti-Lactoferrin (1B8) |
100 ㎕ |
284 |
|
LF-MA0114 |
Anti-Glutathione Peroxidase 3 (23B1) |
100 ㎕ |
320 |
|
LF-MA0116 |
Anti-CDK5 (8A1) |
100 ㎕ |
284 |
|
LF-MA0117 |
Anti-alpha Tubulin (4G1) |
100 ㎕ |
284 |
|
LF-MA0118 |
Anti-Ubiquitin (2A1) |
100 ㎕ |
284 |
|
LF-MA0119 |
Anti-Ubiquitin (4A1) |
100 ㎕ |
284 |
|
LF-MA0120 |
Anti-CDK5 (2G2) |
100 ㎕ |
284 |
|
LF-MA0121 |
Anti-Superoxide Dismutase 3 (1H12) |
100 ㎕ |
320 |
|
LF-MA0126 |
Anti-p38 MAPK (6A1) |
100 ㎕ |
284 |
|
LF-MA0127 |
Anti-Apolipoprotein A-I (2G4) |
100 ㎕ |
284 |
|
LF-MA0130 |
Anti-Green Fluorescent Protein (18A11) |
100 ㎕ |
284 |
|
LF-MA0131 |
Anti-Complement C3 (10A1) |
100 ㎕ |
284 |
|
LF-MA0132 |
Anti-Complement C3 (28A1) |
100 ㎕ |
284 |
|
LF-MA0133 |
Anti-Complement factor H (34F12) |
100 ㎕ |
284 |
|
LF-MA0134 |
Anti-p44/42 MAPK (ERK1/2) (9B3) |
100 ㎕ |
284 |
|
LF-MA0135 |
Anti-PGRP-L (45G1) |
100 ㎕ |
320 |
|
LF-MA0136 |
Anti-C1 inhibitor (4G12) |
100 ㎕ |
284 |
|
LF-MA0137 |
Anti-a2-macroglobulin (2D9) |
100 ㎕ |
284 |
|
LF-MA0138 |
Anti-a2-macroglobulin (9A3) |
100 ㎕ |
284 |
|
LF-MA0139 |
Anti-a2-macroglobulin (3D1) |
100 ㎕ |
284 |
|
LF-MA0140 |
Anti-Chromogranin A (23A1) |
100 ㎕ |
284 |
|
LF-MA0141 |
Anti-Selenoprotein-P (37A1) |
100 ㎕ |
320 |
|
LF-MA0142 |
Anti-Fibronectin (23C9) |
100 ㎕ |
284 |
|
LF-MA0143 |
Anti-C reactive protein (26D7) |
100 ㎕ |
284 |
|
LF-MA0144 |
Anti-Peroxiredoxin II (1E8) |
100 ㎕ |
284 |
|
LF-MA0145 |
Anti-Glutathione Peroxidase 3 (55A) |
100 ㎕ |
284 |
|
LF-MA0146 |
Anti-Attractin (9H8) |
100 ㎕ |
284 |
|
LF-MA0147 |
Anti-Vitamin D binding protein (2B12) |
100 ㎕ |
284 |
|
LF-MA0148 |
Anti-Inter-α-trypsininhibitor (40B10) |
100 ㎕ |
320 |
|
LF-MA0149 |
Anti-Complement Factor H (63G5) |
100 ㎕ |
284 |
|
LF-MA0150 |
Anti-Heparin cofactor II (74E5) |
100 ㎕ |
320 |
|
LF-MA0151 |
Anti-Fibronectin (16E5) |
100 ㎕ |
284 |
|
LF-MA0152 |
Anti-Aβ 40 (Amyloid beta 40) (32A1) |
100 ㎕ |
284 |
|
LF-MA0153 |
Anti-Neurosin (9A7) |
100 ㎕ |
284 |
|
LF-MA0154 |
Anti-MPO(Myeloperoxidase) (1A1) |
100 ㎕ |
284 |
|
LF-MA0155 |
Anti-CDK6 (cyclin-dependent kinase 6) (75B9) |
100 ㎕ |
284 |
|
LF-MA0156 |
Anti-GPI-PLD (38A1) |
100 ㎕ |
320 |
|
LF-MA0157 |
Anti-Haptoglobin (26E11) |
100 ㎕ |
284 |
|
LF-MA0158 |
Anti-Haptoglobin b-chain (2F4) |
100 ㎕ |
320 |
|
LF-MA0159 |
Anti-Ceruloplasmin (3B11) |
100 ㎕ |
284 |
|
LF-MA0160 |
Anti-Serum amyloid P component (6E6) |
100 ㎕ |
284 |
|
LF-MA0161 |
Anti-IKK-α |
100 ㎕ |
284 |
|
LF-MA0162 |
Anti-Retinol binding protein |
100 ㎕ |
284 |
|
LF-MA0163 |
Anti-Human IgG |
100 ㎕ |
284 |
|
LF-MA0164 |
Anti-Human IgM |
100 ㎕ |
284 |
|
LF-MA0165 |
Anti-Human IgA |
100 ㎕ |
284 |
|
LF-MA0166 |
Anti-α1-antichymotrypsin precursor (ACT) |
100 ㎕ |
284 |
|
LF-MA0167 |
Anti-α1-acid glycoprotein (AGP) |
100 ㎕ |
284 |
|
LF-MA0168 |
Anti-Complement factor C9 |
100 ㎕ |
284 |
|
LF-MA0169 |
Anti-Complement factor B |
100 ㎕ |
284 |
|
LF-MA0170 |
Anti-Plasminogen |
100 ㎕ |
284 |
|
LF-MA0171 |
Anti-Prothrombin precursor |
100 ㎕ |
284 |
|
LF-MA0172 |
Anti-pRb (retinoblastoma protein) |
100 ㎕ |
284 |
|
LF-MA0173 |
Anti-pRb (retinoblastoma protein) |
100 ㎕ |
284 |
|
LF-MA0174 |
Anti-Transthyretin |
100 ㎕ |
284 |
|
LF-MA0175 |
α1-antitrypsin |
100 ㎕ |
284 |
|
LF-MA0176 |
Anti-Gelsolin(35B2) |
100 ㎕ |
302 |
|
LF-MA0177 |
Anti-Ad5 Hexon |
100 ㎕ |
302 |
|
LF-MA0178 |
Anti-p44/42 MAPK(ERK1/2)(3A1) |
100 ㎕ |
284 |
|
LF-MA0179 |
Anti-p42 MAPK(ERK2)(1A8) |
100 ㎕ |
284 |
|
LF-MA0180 |
Anti-Inter-α-trypsin inhibitor heavy chain H4(45A12) |
100 ㎕ |
320 |
|
LF-MA0181 |
Anti-Complement factor C8 β propeptide(14A10) |
100 ㎕ |
284 |
|
LF-MA0182 |
Anti-Cytochrome C (14G6) |
100 ㎕ |
284 |
|
LF-MA0183 |
Anti-RSK1 (p90RSK1) (8C12) |
100 ㎕ |
302 |
|
LF-MA0184 |
Anti-Hairy and Enhancer of Split 1 (HES)(7H11) |
100 ㎕ |
302 |
|
LF-MA0185 |
Anti-α-1-B Glycoprotein (A1BG)(54B12) |
100 ㎕ |
284 |
|
LF-MA0186 |
Anti-SHP2 (5F2) |
100 ㎕ |
302 |
|
LF-MA0187 |
Anti-Complement factor C4 (35A12) |
100 ㎕ |
284 |
|
LF-MA0188 |
Anti-Complement factor C4 (49H9) |
100 ㎕ |
284 |
|
LF-MA0189 |
Anti-Plasminogen (9A1) |
100 ㎕ |
284 |
|
LF-MA0190 |
Anti-Plasminogen (44A1) |
100 ㎕ |
284 |
|
LF-MA0191 |
Anti-Bruton's tyrosine kinase (1A1) |
100 ㎕ |
284 |
|
LF-MA0192 |
Anti-IKK beta (42D1) |
100 ㎕ |
284 |
|
LF-MA0193 |
Anti-MAPK/ERK kinase 2 (1A1) |
100 ㎕ |
284 |
|
LF-MA0194 |
Anti-Polo-like kinase 1 (18D4) |
100 ㎕ |
284 |
|
LF-MA0195 |
Anti-PRAK=MAPKAPK5 (13H5) |
100 ㎕ |
302 |
|
LF-MA0196 |
Anti-TAK 1 binding protein 1 (2D3) |
100 ㎕ |
302 |
|
LF-MA0197 |
Anti-ZAP70 (49B4) |
100 ㎕ |
284 |
|
LF-MA0198 |
Anti-Complement C4 beta-chain (52H10) |
100 ㎕ |
284 |
|
LF-MA0199 |
Anti-Bcl-2(2B11) |
100㎕ |
302 |
|
LF-MA0200 |
Anti-Bcl-2(11C5) |
100㎕ |
302 |
|
LF-MA0201 |
Anti-Shc1(47F4) |
100㎕ |
302 |
|
LF-MA0202 |
Anti-Src(5B8) |
100㎕ |
302 |
|
LF-MA0203 |
Anti-Carboxypeptidase N subunit 2 precusor(36A1) |
100㎕ |
302 |
|
LF-MA0204 |
Anti-Kininogen precursor(24F9) |
100㎕ |
302 |
|
LF-MA0205 |
Anti-Vitronectin(10E12) |
100㎕ |
302 |
|
LF-MA0206 |
Anti-Glutathione Peroxidase I(13B2AF) |
100㎕ |
302 |
|
LF-MA0207 |
Anti-Bid(8D2) |
100㎕ |
302 |
|
LF-MA0208 |
Anti-Bid(21F10) |
100㎕ |
302 |
|
LF-MA0209 |
Anti-TRBP(46D1) |
100㎕ |
335 |
|
LF-MA0210 |
Anti-TNF-α(6C10) |
100㎕ |
302 |
|
LF-MA0211 |
Anti-HPK1(2A1) |
100㎕ |
302 |
|
LF-MA0212 |
Anti-SHP1(14D5) |
100㎕ |
302 |
|
LF-MA0213 |
Anti-SHP1(10F5) |
100㎕ |
302 |
|
LF-MA0214 |
Anti-Prx1(3G5) |
100㎕ |
335 |
|
LF-MA0215 |
Anti-Erk1(33A5) |
100 ㎕ |
302 |
|
LF-MA0216 |
Anti-Casein kinase II β(26C3) |
100 ㎕ |
302 |
|
LF-MA0217 |
Anti-Apaf-1(14E3) |
100 ㎕ |
302 |
|
LF-MA0219 |
Anti-PP2A-α/β(13D4) |
100 ㎕ |
302 |
|
LF-MA0220 |
Anti-PP2A-α/β(20G6) |
100 ㎕ |
302 |
|
LF-MA0221 |
Anti-CREB5(7D4) |
100 ㎕ |
335 |
|
LF-MA0222 |
Anti-His-tag(6A7) |
100 ㎕ |
302 |
|
LF-MA0223 |
Anti-Casein Kinase II α(8E5) |
100 ㎕ |
302 |
|
LF-MA0224 |
Anit-Casein Kinase II α(27H4) |
100 ㎕ |
302 |
|
LF-MA0225 |
Anti-Nitrotyrosine (1F1) |
100 ㎕ |
302 |
|
LF-MA0226 |
Anti-α-1 Microglobulin (10A12) |
100 ㎕ |
335 |
|
LF-MA0227 |
Anti-α-B Glycoprotein (A1BG) (51A6) |
100 ㎕ |
375 |
|
LF-MA0228 |
Anti-Transthyretin(Prealbumin)(9G6) |
100 ㎕ |
302 |
|
LF-MA0229 |
Anti-Troponin I (3D10) |
100 ㎕ |
302 |
|
LF-MA0230 |
Anti-Complement C6(8G7) |
100 ㎕ |
375 |
|
LF-MA0231 |
Anti-Complement C6(13H5) |
100 ㎕ |
375 |
|
LF-MA0232 |
Anti-Creatine kinase-BB(CK-BB)(3A6) |
100 ㎕ |
302 |
|
LF-MA0233 |
Anti-Creatine kinase-M/B(CK-M/B)(46A1) |
100 ㎕ |
302 |
|
LF-MA0234 |
Anti-Creatine kinase-MM(CK-MM)(2C5) |
100 ㎕ |
302 |
|
LF-MA0235 |
Anti-IkBα(7A4) |
100 ㎕ |
302 |
|
LF-MA0236 |
Anti-Nuclear factor kappa B(NF-kB) p105/50(13A2F) |
100 ㎕ |
302 |
|
LF-MA0237 |
Anti-RIP1(7H10) |
100 ㎕ |
302 |
|
LF-MA0238 |
Anti-Syk(8H5) |
100 ㎕ |
302 |
|
LF-MA0239 |
Anti-Syk(12E3) |
100 ㎕ |
302 |
|
LF-MA0240 |
Anti-FAK1(63D5) |
100 ㎕ |
302 |
|
LF-MA0241 |
Anti-Transferrin(3C11) |
100 ㎕ |
302 |
|
LF-MA0242 |
Anti-Transferrin(14C10) |
100 ㎕ |
302 |
|
LF-MA0243 |
Anti-Myoglobin(15H1) |
100 ㎕ |
302 |
|
LF-MA0244 |
Anti-PIWIL2(11C11) |
100 ㎕ |
302 |
|
LF-MA0246 |
Anti-ATM(Ataxia telangiectasia mutated kinase)(1B10) |
100 ㎕ |
302 |
|
LF-MA0247 |
Anti-CDK7(Cyclin-dependent kinase 7)(3E3) |
100 ㎕ |
302 |
|
LF-MA0248 |
Anti-CDK7(Cyclin-dependent kinase 7)(45H1) |
100 ㎕ |
302 |
|
LF-MA0249 |
Anti-MEK1(MAPK/ERK kinase 1 = MAPKK1)(32G3) |
100 ㎕ |
302 |
|
LF-MA0250 |
Anti-Mnk1(MAP kinase-interacting serine/threonine-protein kinase)(24C2) |
100 ㎕ |
302 |
|
LF-MA0251 |
Anti-R-Ras(6A8) |
100 ㎕ |
302 |
|
LF-MA0252 |
Anti-RSK2/3(p90 ribosomal S6 kinase 2/3)(3C1) |
100 ㎕ |
302 |
|
LF-MA0253 |
Anti-DUSP3(Dual specific protein phosphatase 3 = VHR)(ARM-1) |
100 ㎕ |
302 |
|
LF-MA0254 |
Anti-ATM(Ataxia telangiectasia mutated kinase)(9A2) |
100 ㎕ |
302 |
|
LF-MA0255 |
Anti-CAD(caspase-activated Dnase) (4B8) |
100 ㎕ |
302 |
|
LF-MA0256 |
Anti-Cdc2(6C9) |
100 ㎕ |
302 |
|
LF-MA0257 |
Anti-Cdc2(26E11) |
100 ㎕ |
302 |
|
LF-MA0258 |
Anti-Complement C1q (9A7) |
100 ㎕ |
302 |
|
LF-MA0259 |
Anti-Lyn (11A7) |
100 ㎕ |
302 |
|
LF-MA0260 |
Anti-MEK3 (3G2) |
100 ㎕ |
302 |
|
LF-MA0261 |
Anti-NFkB p52 (9D2) |
100 ㎕ |
302 |
|
LF-MA0262 |
Anti-Smad2 (7A5) |
100 ㎕ |
302 |
|
LF-MA0263 |
Anti-Vimentin (23H2) |
100 ㎕ |
302 |
|
LF-MA0264 |
Anti-Vimentin (33C7) |
100 ㎕ |
302 |
|
LF-MA0265 |
Anti-Vimentin (35E2) |
100 ㎕ |
302 |
|
LF-MA0266 |
anti-Chk2 (Checkpoint kinase 2) (20A8) |
100 ㎕ |
302 |
|
LF-MA0267 |
anti-Chk2 (Checkpoint kinase 2) (31A2) |
100 ㎕ |
302 |
|
LF-MA0268 |
anti-Thyroglobulin (7C2) |
100 ㎕ |
302 |
|
LF-MA0269 |
anti-β-hCG (Human chorionic gonadotropin) (7H4) |
100 ㎕ |
302 |
|
LF-MA0270 |
anti-FAK1 (Focal adhesion kinase 1) (1D10) |
100 ㎕ |
302 |
|
LF-MA0271 |
anti-Smad4 (26C4) |
100 ㎕ |
302 |
|
LF-MA0272 |
anti-Smad4 (31G4) |
100 ㎕ |
302 |
|
LF-MA0273 |
anti-PON3 (Paraoxonase 3) (5G11) |
100 ㎕ |
302 |
|
LF-MA0274 |
anti-STEP (Tyrosine-protein phosphatase non receptor type 5) (T41) |
100 ㎕ |
301 |
|
LF-MA0275 |
anti-CEA (Carcinoembryonic antigen) (36H1) |
100 ㎕ |
301 |
|
LF-MA0276 |
anti-CEA (Carcinoembryonic antigen) (37B6) |
100 ㎕ |
301 |
|
LF-MA0277 |
anti-Hemoglobin (7E1F) |
100 ㎕ |
301 |
|
LF-MA0278 |
anti-Nck (11D10) |
100 ㎕ |
301 |
|
LF-MA0279 |
anti-RSK3 (3A3) |
100 ㎕ |
301 |
|
LF-MA0280 |
Anti-AFP (Alpha-fetoprotein) (3B1) |
100 ㎕ |
302 |
|
LF-MA0281 |
Anti-AFP (Alpha-fetoprotein) (8H2) |
100 ㎕ |
302 |
|
LF-MA0282 |
Anti-DJ-1 (PARK7) (1D7) |
100 ㎕ |
302 |
|
LF-MA0283 |
Anti-AChE (Acetylcholinestersase) (3A5) |
100 ㎕ |
302 |
|
LF-MA0284 |
Anti-Ferritin heavy chain (3F8) |
100 ㎕ |
302 |
|
LF-MA0285 |
Anti-phospho-HSP27 (S82) (41A8) |
100 ㎕ |
302 |
|
LF-MA0286 |
Anti-PTEN (16F3) |
100 ㎕ |
302 |
|
LF-MA0287 |
Anti-PTEN (22F2) |
100 ㎕ |
302 |
|
LF-MA0288 |
Anti-RIP2 (AF28D3) |
100 ㎕ |
302 |
|
LF-MA0289 |
Anti-p21 (AF9D10) |
100 ㎕ |
302 |
|
LF-MA0290 |
Anti-IRS2 (AF2F2) |
100 ㎕ |
302 |
|
LF-MA0291 |
Anti-MEK6 (MAP kinase kinase 6) (AF4G6) |
100 ㎕ |
302 |
|
LF-MA0292 |
Anti-MEK6 (MAP kinase kinase 6) (AF8B6) |
100 ㎕ |
302 |
|
LF-MA0293 |
Anti-Smad1/5 (AF10B7) |
100 ㎕ |
302 |
|
LF-MA0294 |
Anti-Jak1 (AF28B1) |
100 ㎕ |
302 |
|
LF-MA0295 |
Anti-Hsp27 (AF5E5) |
100 ㎕ |
302 |
|
LF-MA0296 |
anti-cofilin (AF2C2) |
100 ㎕ |
302 |
|
LF-MA0297 |
anti-cdk4 (AF10A4) |
100 ㎕ |
302 |
|
LF-MA0298 |
anti-His (AF2C6-6A1) |
100 ㎕ |
302 |
|
LF-MA0299 |
anti-smad3 (AF9F7) |
100 ㎕ |
302 |
|
LF-MA0300 |
anti-ICAD (AF24G5) |
100 ㎕ |
302 |
|
LF-MA0301 |
anti-ICAD (AF41E3) |
100 ㎕ |
302 |
|
LF-MA0302 |
anti-MKP2 (AFPK7) |
100 ㎕ |
302 |
|
LF-MA0303 |
anti-FOXO1 (AF4A3) |
100 ㎕ |
302 |
|
LF-MA0304 |
anti-R-PTP rho (AFT20) |
100 ㎕ |
302 |
|
LF-MA0305 |
anti-Aurora B (AF7B11) |
100 ㎕ |
302 |
|
LF-MA0306 |
anti-HePTP (AFPK32) |
100 ㎕ |
301 |
|
LF-MA0308 |
anti-Calbindin 1 (AF2E5) |
100 ㎕ |
302 |
|
LF-MA0309 |
anti-ILK (AF22F1) |
100 ㎕ |
302 |
|
LF-MA0310 |
anti-IA-2 (AFT38) |
100 ㎕ |
302 |
|
LF-MA0311 |
anti-p53 (AF2C1) |
100 ㎕ |
302 |
|
LF-MA0312 |
anti-UCHL3 (AF9G8) |
100 ㎕ |
302 |
|
LF-MA20055 |
anti-beta-actin |
100ug |
284 |
|
LF-MA20056 |
anti-beta-tubulin |
100ug |
284 |
|
LF-MA20168 |
anti-Flag-Tag |
100ug |
284 |
|
LF-MA20175 |
anti-GAPDH |
100ug |
284 |
|
LF-MA20181 |
anti-GFP-Tag |
100ug |
284 |
|
LF-MA20193 |
anti-HA-Tag |
100ug |
284 |
|
LF-MA20209 |
anti-His-Tag |
100ug |
284 |
|
LF-MA20312 |
anti-Myc-Tag |
100ug |
284 |
|
LF-PA0002 |
Anti-Thioredoxin 1 |
100 ㎕ |
302 |
|
LF-PA0003 |
Anti-Ferredoxin Reductase |
100 ㎕ |
335 |
|
LF-PA0004 |
Anti-Peroxiredoxin-SO3 |
100 ㎕ |
575 |
|
LF-PA0005 |
Anti-Peroxiredoxin Ⅵ-SO3 |
100 ㎕ |
575 |
|
LF-PA0006 |
Anti-Glyceraldehyde-3-Phosphate Dehydrogenase (GAPDH)-SO3 |
100 ㎕ |
575 |
|
LF-PA0007 |
Anti-Peroxiredoxin Ⅱ |
100 ㎕ |
335 |
|
LF-PA0009 |
Anti-Peroxiredoxin Ⅳ |
100 ㎕ |
335 |
|
LF-PA0010 |
Anti-Peroxiredoxin Ⅴ |
100 ㎕ |
302 |
|
LF-PA0011 |
Anti-Peroxiredoxin Ⅵ |
100 ㎕ |
335 |
|
LF-PA0012 |
Anti-Thioredoxin 2 |
100 ㎕ |
335 |
|
LF-PA0013 |
Anti-Superoxide Dismutase 1 |
100 ㎕ |
302 |
|
LF-PA0017 |
Anti-Glutaredoxin 1 |
100 ㎕ |
335 |
|
LF-PA0018 |
Anti-Glyceraldehyde-3-Phosphate Dehydrogenase (GAPDH) |
100 ㎕ |
302 |
|
LF-PA0021 |
Anti-Superoxide Dismutase 2 |
100 ㎕ |
302 |
|
LF-PA0022 |
Anti-Superoxide Dismutase 4 |
100 ㎕ |
335 |
|
LF-PA0023 |
Anti-Thioredoxin Reductase 1 |
100 ㎕ |
302 |
|
LF-PA0024 |
Anti-Thioredoxin Reductase 2 |
100 ㎕ |
302 |
|
LF-PA0025 |
Anti-p-H2AX |
100 ㎕ |
335 |
|
LF-PA0030 |
Anti-Peroxiredoxin Ⅲ |
100 ㎕ |
335 |
|
LF-PA0031 |
Anti-Methionine Sulfoxide Reductase A |
100 ㎕ |
302 |
|
LF-PA0033 |
Anti-Phospho-PDGF Receptor β (Y579) |
100 ㎕ |
394 |
|
LF-PA0035 |
Anti-Phospho-PDGF Receptor β (Y716) |
100 ㎕ |
394 |
|
LF-PA0036 |
Anti-Phospho-PDGF Receptor β (Y740) |
100 ㎕ |
394 |
|
LF-PA0038 |
Anti-Phospho-PDGF Receptor β (Y771) |
100 ㎕ |
394 |
|
LF-PA0039 |
Anti-Phospho-PDGF Receptor β (Y857) |
100 ㎕ |
394 |
|
LF-PA0040 |
Anti-Phospho-PDGF Receptor β (Y1009) |
100 ㎕ |
394 |
|
LF-PA0041 |
Anti-Phospho-PDGF Receptor β (Y1021) |
100 ㎕ |
394 |
|
LF-PA0043 |
Anti-Green Fluorescent Protein |
100 ㎕ |
302 |
|
LF-PA0044 |
Anti-Caspase-2 |
100 ㎕ |
302 |
|
LF-PA0045 |
Anti-Smac/Diablo |
100 ㎕ |
302 |
|
LF-PA0046 |
Anti-PP2Ac-a |
100 ㎕ |
302 |
|
LF-PA0047 |
Anti-JNK1 |
100 ㎕ |
302 |
|
LF-PA0048 |
Anti-ROCK1 |
100 ㎕ |
302 |
|
LF-PA0049 |
Anti-ROCK2 |
100 ㎕ |
302 |
|
LF-PA0050 |
Anti-p53 |
100 ㎕ |
302 |
|
LF-PA0051 |
Anti-MSK2 |
100 ㎕ |
302 |
|
LF-PA0052 |
Anti-MPO(Myeloperoxidase) |
100 ㎕ |
302 |
|
LF-PA0053 |
Anti-Cyclin D3 |
100 ㎕ |
302 |
|
LF-PA0055 |
Anti-Glutathione Peroxidase 4 |
100 ㎕ |
335 |
|
LF-PA0056 |
Anti-Glutathione Reductase |
100 ㎕ |
335 |
|
LF-PA0057 |
Anti-CAD(caspase-activated Dnase, DFF40) |
100 ㎕ |
302 |
|
LF-PA0058 |
Anti-ICAD(Inhibitor of CAD, DFF45) |
100 ㎕ |
302 |
|
LF-PA0059 |
Anti-Chk1(Checkpoint kinase 1) |
100 ㎕ |
302 |
|
LF-PA0060 |
Anti-Catalase |
100 ㎕ |
302 |
|
LF-PA0062 |
Anti-NF-κB RelA |
100 ㎕ |
302 |
|
LF-PA0065 |
Anti-STAT2 (signal transducer and activator of transcription) |
100 ㎕ |
302 |
|
LF-PA0066 |
Anti-β-Actin(C-term) |
100 ㎕ |
302 |
|
LF-PA0067 |
Anti-Nitrotyrosine |
100 ㎕ |
302 |
|
LF-PA0068 |
Anti-STAT5a (signal transducer and activator of transcription) |
100 ㎕ |
302 |
|
LF-PA0069 |
Anti-STAT5b (signal transducer and activator of transcription) |
100 ㎕ |
302 |
|
LF-PA0071 |
Anti-Phospho-Stat3 (Y705) |
100 ㎕ |
302 |
|
LF-PA0072 |
Anti-Syk |
100 ㎕ |
302 |
|
LF-PA0073 |
Anti-PKC nu (Protein kinase C nu) |
100 ㎕ |
302 |
|
LF-PA0074 |
Anti-Lyn |
100 ㎕ |
302 |
|
LF-PA0075 |
Anti-Nck1 |
100 ㎕ |
302 |
|
LF-PA0077 |
Anti-14-3-3 β |
100 ㎕ |
302 |
|
LF-PA0078 |
Anti-Ubiquitin |
100 ㎕ |
302 |
|
LF-PA0079 |
Anti-Diazepam Binding Inhibitor |
100 ㎕ |
335 |
|
LF-PA0080 |
Anti-Pyk2(RAFTK) |
100 ㎕ |
302 |
|
LF-PA0081 |
Anti-Catecholamine Sulfating Phenol Sufotranferase |
100 ㎕ |
335 |
|
LF-PA0082 |
Anti-Phospho-EGFR (Y1173)/Her2 (Y1248) |
100 ㎕ |
302 |
|
LF-PA0083 |
Anti-Casein kinase 1 α |
100 ㎕ |
284 |
|
LF-PA0084 |
Anti-PKC epsilon |
100 ㎕ |
302 |
|
LF-PA0085 |
Anti-IRS4 |
100 ㎕ |
302 |
|
LF-PA0086 |
Anti-Peroxiredoxin Ⅰ |
100 ㎕ |
302 |
|
LF-PA0087 |
Anti-Glutathione Peroxidase 1 |
100 ㎕ |
302 |
|
LF-PA0088 |
Anti-Methionine sulfoxide reductase B |
100 ㎕ |
335 |
|
LF-PA0089 |
Anti-Phospho-p38 MAPK (Thr180/Tyr182) |
100 ㎕ |
303 |
|
LF-PA0090 |
Anti-Phospho-p44/42 MAPK (Thr202/Tyr204) |
100 ㎕ |
303 |
|
LF-PA0091 |
Anti-Peroxiredoxin II |
100 ㎕ |
335 |
|
LF-PA0092 |
Anti-Noggin |
100 ㎕ |
302 |
|
LF-PA0093 |
Anti-Bone morphogenetic protein 4(BMP4) |
100 ㎕ |
302 |
|
LF-PA0094 |
Anti-phospho-PDGF Receptor β(Y1021) |
100 ㎕ |
394 |
|
LF-PA0095 |
Anti-Peroxiredoxin I |
100 ㎕ |
302 |
|
LF-PA0099 |
Anti-Ad5 Hexon |
100 ㎕ |
302 |
|
LF-PA0100 |
Anti-Glutamine Synthetase |
100 ㎕ |
302 |
|
LF-PA0101 |
Anti-Ubiquitin+1 |
100 ㎕ |
302 |
|
LF-PA0102 |
Anti-Transthyretin |
100 ㎕ |
302 |
|
LF-PA0108 |
Anti-gamma Enolase |
100 ㎕ |
302 |
|
LF-PA0109 |
Anti-Lactoferrin |
100 ㎕ |
302 |
|
LF-PA0113 |
Anti-Synaptotagmin VI |
100 ㎕ |
335 |
|
LF-PA0117 |
Anti-Transglutaminase 2 |
100 ㎕ |
302 |
|
LF-PA0128 |
Anti-SUMO 1 |
100 ㎕ |
335 |
|
LF-PA0132 |
Anti-CDK5 |
100 ㎕ |
302 |
|
LF-PA0140 |
Anti-beta catenin(N-term) |
100 ㎕ |
302 |
|
LF-PA0141 |
Anti-CyclinD1 |
100 ㎕ |
302 |
|
LF-PA0146 |
Anti-alpha Tubulin |
100 ㎕ |
302 |
|
LF-PA0148 |
Anti-beta Actin |
100 ㎕ |
302 |
|
LF-PA0155 |
Anti-VDAC 1 |
100 ㎕ |
302 |
|
LF-PA0160 |
Anti-p38 MAPK |
100 ㎕ |
302 |
|
LF-PA0162 |
Anti-beta catenin(C-term) |
100 ㎕ |
302 |
|
LF-PA0166 |
Anti-Akt |
100 ㎕ |
302 |
|
LF-PA0167 |
Anti-Cdc25A |
100 ㎕ |
302 |
|
LF-PA0168 |
Anti-Cyclin E1 |
100 ㎕ |
302 |
|
LF-PA0169 |
Anti-p44 MAPK(Erk1) |
100 ㎕ |
302 |
|
LF-PA0170 |
Anti-RelB |
100 ㎕ |
302 |
|
LF-PA0171 |
Anti-Stat1 |
100 ㎕ |
302 |
|
LF-PA0172 |
Anti-Tau(396) |
100 ㎕ |
302 |
|
LF-PA0173 |
Anti-IRAK4 |
100 ㎕ |
302 |
|
LF-PA0174 |
Anti-PKC γ(Protein kinase C gamma) |
100 ㎕ |
302 |
|
LF-PA0175 |
Anti-PKC α(Protein kinase C α) |
100 ㎕ |
302 |
|
LF-PA0176 |
Anti-Ferritin H-chain |
100 ㎕ |
302 |
|
LF-PA0177 |
Anti-FAK1 |
100 ㎕ |
302 |
|
LF-PA0178 |
Anti-Bcl-2(B cell lymphoma 2) |
100 ㎕ |
302 |
|
LF-PA0179 |
Anti-p130(130 kDa retinoblastoma-associated protein = Retinoblastoma-like protein 2 = RBL 2) |
100 ㎕ |
302 |
|
LF-PA0180 |
Anti-Vimentin |
100 ㎕ |
302 |
|
LF-PA0181 |
Anti-Transferrin |
100 ㎕ |
302 |
|
LF-PA0182 |
Anti-Bid |
100 ㎕ |
302 |
|
LF-PA0183 |
anti-MEK6 (MAP kinase kinase 6) |
100 ㎕ |
302 |
|
LF-PA0184 |
anti-Cdc2 |
100 ㎕ |
302 |
|
LF-PA0185 |
anti-AFP (Alpha-fetoprotein) |
100 ㎕ |
302 |
|
LF-PA0186 |
anti-EGFR |
100 ㎕ |
302 |
|
LF-PA0187 |
anti-Trx1 |
100 ㎕ |
301 |
|
LF-PA0188 |
anti-Dvl3 |
100 ㎕ |
301 |
|
LF-PA0189 |
anti-GST |
100 ㎕ |
301 |
|
LF-PA0190 |
anti-Ub+1 |
100 ㎕ |
301 |
|
LF-PA0191 |
Anti-DJ-1 (PARK7) |
100 ㎕ |
302 |
|
LF-PA0192 |
Anti-Nck1/2 |
100 ㎕ |
302 |
|
LF-PA0193 |
Anti-CKII beta (Casein kinase II beta) |
100 ㎕ |
302 |
|
LF-PA0194 |
Anti-pan-Synuclein |
100 ㎕ |
302 |
|
LF-PA0195 |
Anti-C-raf |
100 ㎕ |
301 |
|
LF-PA0196 |
Anti-γ Synuclein |
100 ㎕ |
301 |
|
LF-PA0197 |
Anti-UCHL1/3 |
100 ㎕ |
301 |
|
LF-PA0198 |
anti-ILK |
100 ㎕ |
301 |
|
LF-PA0199 |
anti-p-Erk1/2 (pT202/Y204) |
100 ㎕ |
301 |
|
LF-PA0200 |
anti-Hsp27 |
100 ㎕ |
301 |
|
LF-PA0201 |
anti-p-p53 (S6) |
100 ㎕ |
301 |
|
LF-PA0202 |
anti-p-Hsp27 (S82) |
100 ㎕ |
301 |
|
LF-PA0203 |
anti-Cortactin |
100 ㎕ |
301 |
|
LF-PA20001 |
anti-14-3-3 ζ (Ab-58) |
100ug |
284 |
|
LF-PA20002 |
anti-14-3-3 ζ (Phospho-Ser58) |
100ug |
335 |
|
LF-PA20003 |
anti-4E-BP1 (Ab-36) |
100ug |
284 |
|
LF-PA20004 |
anti-4E-BP1 (Ab-45) |
100ug |
284 |
|
LF-PA20005 |
anti-4E-BP1 (Phospho-Thr36) |
100ug |
335 |
|
LF-PA20006 |
anti-4E-BP1 (Phospho-Thr45) |
100ug |
335 |
|
LF-PA20007 |
anti-ADD1 (Ab-726) |
100ug |
284 |
|
LF-PA20008 |
anti-ADD1 (Phospho-Ser726) |
100ug |
335 |
|
LF-PA20009 |
anti-AFX (Ab-197) |
100ug |
284 |
|
LF-PA20010 |
anti-AFX (Phospho-Ser197) |
100ug |
335 |
|
LF-PA20011 |
anti-Akt (Ab-308) |
100ug |
284 |
|
LF-PA20012 |
anti-Akt (Ab-473) |
100ug |
284 |
|
LF-PA20013 |
anti-Akt (Phospho-Ser473) |
100ug |
335 |
|
LF-PA20014 |
anti-Akt (Phospho-Thr308) |
100ug |
335 |
|
LF-PA20015 |
anti-Akt2 (Ab-474) |
100ug |
284 |
|
LF-PA20016 |
anti-Akt2 (Phospho-Ser474) |
100ug |
335 |
|
LF-PA20017 |
anti-AMPK1 (Ab-174) |
100ug |
284 |
|
LF-PA20018 |
anti-AMPK1 (Phospho-Thr174) |
100ug |
335 |
|
LF-PA20019 |
anti-AMPK1/AMPK2 (Ab-485/491) |
100ug |
284 |
|
LF-PA20020 |
anti-AMPK1/AMPK2 (Phospho-Ser485/Ser491) |
100ug |
335 |
|
LF-PA20021 |
anti-APP (Ab-668) |
100ug |
284 |
|
LF-PA20022 |
anti-APP (Phospho-668) |
100ug |
335 |
|
LF-PA20023 |
anti-ASK1 (Ab-83) |
100ug |
284 |
|
LF-PA20024 |
anti-ASK1 (Ab-966) |
100ug |
284 |
|
LF-PA20025 |
anti-ASK1 (Phospho-Ser83) |
100ug |
335 |
|
LF-PA20026 |
anti-ASK1 (Phospho-Ser966) |
100ug |
335 |
|
LF-PA20027 |
anti-ATF2 (Ab-112 or 94) |
100ug |
284 |
|
LF-PA20028 |
anti-ATF2 (Ab-62 or 44) |
100ug |
284 |
|
LF-PA20029 |
anti-ATF2 (Ab-69 or 51) |
100ug |
284 |
|
LF-PA20030 |
anti-ATF2 (Ab-71 or 53) |
100ug |
284 |
|
LF-PA20031 |
anti-ATF2 (Ab-73 or 55) |
100ug |
284 |
|
LF-PA20032 |
anti-ATF2 (Phospho-Ser112 or 94) |
100ug |
335 |
|
LF-PA20033 |
anti-ATF2 (Phospho-Ser62 or 44) |
100ug |
335 |
|
LF-PA20034 |
anti-ATF2 (Phospho-Thr69 or 51) |
100ug |
335 |
|
LF-PA20035 |
anti-ATF2 (Phospho-Thr71 or 53) |
100ug |
335 |
|
LF-PA20036 |
anti-ATF2 (Phospho-Thr73 or 55) |
100ug |
335 |
|
LF-PA20037 |
anti-ATF4 (Ab-245) |
100ug |
284 |
|
LF-PA20038 |
anti-ATF4 (Phospho-Ser245) |
100ug |
335 |
|
LF-PA20039 |
anti-ATM (Phospho-Ser1981) |
100ug |
335 |
|
LF-PA20040 |
anti-BAD (Ab-112) |
100ug |
284 |
|
LF-PA20041 |
anti-BAD (Ab-136) |
100ug |
284 |
|
LF-PA20042 |
anti-BAD (Ab-155) |
100ug |
284 |
|
LF-PA20043 |
anti-BAD (Phospho-Ser112) |
100ug |
335 |
|
LF-PA20044 |
anti-BAD (Phospho-Ser155) |
100ug |
335 |
|
LF-PA20045 |
anti-BCL-2 (Ab-56) |
100ug |
284 |
|
LF-PA20046 |
anti-BCL-2 (Ab-70) |
100ug |
284 |
|
LF-PA20047 |
anti-BCL-2 (Phospho-Ser70) |
100ug |
335 |
|
LF-PA20048 |
anti-BCL-2 (Phospho-Thr56) |
100ug |
335 |
|
LF-PA20049 |
anti-BCL-XL (Ab-62) |
100ug |
284 |
|
LF-PA20050 |
anti-BCL-XL (Phospho-Ser62) |
100ug |
335 |
|
LF-PA20051 |
anti-Bcr (Ab-177) |
100ug |
284 |
|
LF-PA20052 |
anti-Bcr (Phospho-Tyr177) |
100ug |
335 |
|
LF-PA20053 |
anti-beta-actin |
100ug |
284 |
|
LF-PA20056 |
anti-BIM(Ab-65) |
100ug |
284 |
|
LF-PA20057 |
anti-BIM(Phospho-Ser69/65) |
100ug |
335 |
|
LF-PA20058 |
anti-BRCA1 (Phospho-Ser1524) |
100ug |
335 |
|
LF-PA20059 |
anti-BRCA1(Ab-1423) |
100ug |
284 |
|
LF-PA20060 |
anti-BRCA1(Phospho-Ser1423) |
100ug |
335 |
|
LF-PA20061 |
anti-c-Abl (Ab-412) |
100ug |
284 |
|
LF-PA20062 |
anti-c-Abl (Phospho-Tyr412) |
100ug |
335 |
|
LF-PA20063 |
anti-CaMKII (Ab-286) |
100ug |
284 |
|
LF-PA20064 |
anti-CaMKII (Phospho-Thr286) |
100ug |
335 |
|
LF-PA20065 |
anti-CARM1 (Ab-228) antibody |
100ug |
284 |
|
LF-PA20066 |
anti-CARM1 (Phospho-Ser228) antibody |
100ug |
335 |
|
LF-PA20067 |
anti-Caveolin-1 (Ab-14) |
100ug |
284 |
|
LF-PA20068 |
anti-Caveolin-1 (Phospho-Tyr14) |
100ug |
335 |
|
LF-PA20069 |
anti-CDC2 (Ab-15) |
100ug |
284 |
|
LF-PA20070 |
anti-CDC2 (Ab-161) |
100ug |
284 |
|
LF-PA20071 |
anti-CDC2 (Phospho-Thr161) |
100ug |
335 |
|
LF-PA20072 |
anti-CDC2 (Phospho-Tyr15) |
100ug |
335 |
|
LF-PA20073 |
anti-cdc25A (Ab-75) |
100ug |
284 |
|
LF-PA20074 |
anti-cdc25A (Phospho-Ser75) |
100ug |
335 |
|
LF-PA20075 |
anti-cdc25C (Ab-216) |
100ug |
284 |
|
LF-PA20076 |
anti-cdc25C (Phospho-Ser216) |
100ug |
335 |
|
LF-PA20077 |
anti-CDK2 (Ab-160) |
100ug |
284 |
|
LF-PA20078 |
anti-CDK2 (Phospho-Thr160) |
100ug |
335 |
|
LF-PA20079 |
anti-Chk1 (Ab-280) |
100ug |
284 |
|
LF-PA20080 |
anti-Chk1 (Ab-317) |
100ug |
284 |
|
LF-PA20081 |
anti-Chk1 (Phospho-Ser345) |
100ug |
335 |
|
LF-PA20082 |
anti-Chk2 (Ab-68) |
100ug |
284 |
|
LF-PA20083 |
anti-Chk2 (Phospho-Ser516) |
100ug |
335 |
|
LF-PA20084 |
anti-Chk2 (Phospho-Thr68) |
100ug |
335 |
|
LF-PA20085 |
anti-c-Jun (Ab-170) |
100ug |
284 |
|
LF-PA20086 |
anti-c-Jun (Ab-239) |
100ug |
284 |
|
LF-PA20087 |
anti-c-Jun (Ab-243) |
100ug |
284 |
|
LF-PA20088 |
anti-c-Jun (Ab-63) |
100ug |
284 |
|
LF-PA20089 |
anti-c-Jun (Ab-73) |
100ug |
284 |
|
LF-PA20090 |
anti-c-Jun (Ab-91) |
100ug |
284 |
|
LF-PA20091 |
anti-c-Jun (Ab-93) |
100ug |
284 |
|
LF-PA20092 |
anti-c-Jun (Phospho-Ser243) |
100ug |
335 |
|
LF-PA20093 |
anti-c-Jun (Phospho-Ser63) |
100ug |
335 |
|
LF-PA20094 |
anti-c-Jun (Phospho-Ser73) |
100ug |
335 |
|
LF-PA20095 |
anti-c-Jun (Phospho-Thr239) |
100ug |
335 |
|
LF-PA20096 |
anti-c-Jun (Phospho-Thr91) |
100ug |
335 |
|
LF-PA20097 |
anti-c-Jun (Phospho-Thr93) |
100ug |
335 |
|
LF-PA20098 |
anti-c-Jun (Phospho-Tyr170) |
100ug |
335 |
|
LF-PA20099 |
anti-c-Kit (Phospho-Tyr721) |
100ug |
335 |
|
LF-PA20100 |
anti-cofilin (Ab-3) |
100ug |
284 |
|
LF-PA20101 |
anti-cofilin (Phospho-Ser3) |
100ug |
335 |
|
LF-PA20102 |
anti-Connexin 43 (Ab-367) |
100ug |
284 |
|
LF-PA20103 |
anti-Connexin 43 (phospho-Ser367) |
100ug |
335 |
|
LF-PA20104 |
anti-Cortactin(Ab-421) |
100ug |
284 |
|
LF-PA20105 |
anti-Cortactin(Ab-466) |
100ug |
284 |
|
LF-PA20106 |
anti-Cortactin(Phospho-Tyr466) |
100ug |
335 |
|
LF-PA20107 |
anti-CREB (Ab-129) |
100ug |
284 |
|
LF-PA20108 |
anti-CREB (Ab-133) |
100ug |
284 |
|
LF-PA20109 |
anti-CREB (Phospho-Ser129) |
100ug |
335 |
|
LF-PA20110 |
anti-CREB (Phospho-Ser133) |
100ug |
335 |
|
LF-PA20111 |
anti-Dab1 (Ab-232) |
100ug |
284 |
|
LF-PA20112 |
anti-DNA PKcs (Ab-2609) antibody |
100ug |
284 |
|
LF-PA20113 |
anti-DNA PKcs (Phospho-Thr2609) antibody |
100ug |
335 |
|
LF-PA20114 |
anti-EGFR (Ab-1070) |
100ug |
284 |
|
LF-PA20115 |
anti-EGFR (Ab-1092) |
100ug |
284 |
|
LF-PA20116 |
anti-EGFR (Ab-1110) |
100ug |
284 |
|
LF-PA20117 |
anti-EGFR (Ab-1172) |
100ug |
284 |
|
LF-PA20118 |
anti-EGFR (Ab-1197) |
100ug |
284 |
|
LF-PA20119 |
anti-EGFR (Ab-678) |
100ug |
284 |
|
LF-PA20120 |
anti-EGFR (Ab-693) |
100ug |
284 |
|
LF-PA20121 |
anti-EGFR (Ab-869) |
100ug |
284 |
|
LF-PA20122 |
anti-EGFR (Phospho-Ser1070) |
100ug |
335 |
|
LF-PA20123 |
anti-EGFR (Phospho-Thr678) |
100ug |
335 |
|
LF-PA20124 |
anti-EGFR (Phospho-Thr693) |
100ug |
335 |
|
LF-PA20125 |
anti-EGFR (Phospho-Tyr1092) |
100ug |
335 |
|
LF-PA20126 |
anti-EGFR (phospho-Tyr1110) |
100ug |
335 |
|
LF-PA20127 |
anti-EGFR (Phospho-Tyr1172) |
100ug |
335 |
|
LF-PA20128 |
anti-EGFR (Phospho-Tyr1197) |
100ug |
335 |
|
LF-PA20129 |
anti-EGFR (Phospho-Tyr869) |
100ug |
335 |
|
LF-PA20130 |
anti-eIF2α (Ab-51) |
100ug |
284 |
|
LF-PA20131 |
anti-eIF2α (Phospho-Ser51) |
100ug |
335 |
|
LF-PA20132 |
anti-eIF4E (Ab-209) |
100ug |
284 |
|
LF-PA20133 |
anti-eIF4E (Phospho-Ser209) |
100ug |
335 |
|
LF-PA20134 |
anti-Elk-1 (Ab-383) |
100ug |
284 |
|
LF-PA20135 |
anti-Elk1 (Ab-389) |
100ug |
284 |
|
LF-PA20136 |
anti-Elk1 (Ab-417) |
100ug |
284 |
|
LF-PA20137 |
anti-Elk-1 (Phospho-Ser383) |
100ug |
335 |
|
LF-PA20138 |
anti-Elk1 (Phospho-Ser389) |
100ug |
335 |
|
LF-PA20139 |
anti-Elk1 (Phospho-Thr417) |
100ug |
335 |
|
LF-PA20140 |
anti-Ephrin-B2 (Ab-316) |
100ug |
284 |
|
LF-PA20141 |
anti-Ephrin-B2 (Ab-330) |
100ug |
284 |
|
LF-PA20142 |
anti-Estrogen Receptor-α (Phospho-Ser104) |
100ug |
335 |
|
LF-PA20143 |
anti-Estrogen Receptor-α (Ab-104) |
100ug |
284 |
|
LF-PA20144 |
anti-Estrogen Receptor-α (Ab-106) |
100ug |
284 |
|
LF-PA20145 |
anti-Estrogen Receptor-α (Ab-118) |
100ug |
284 |
|
LF-PA20146 |
anti-Estrogen Receptor-α (Ab-167) |
100ug |
284 |
|
LF-PA20147 |
anti-Estrogen Receptor-α (Phospho-Ser106) |
100ug |
335 |
|
LF-PA20148 |
anti-Estrogen Receptor-α (Phospho-Ser118) |
100ug |
335 |
|
LF-PA20149 |
anti-Estrogen Receptor-α (Phospho-Ser167) |
100ug |
335 |
|
LF-PA20150 |
anti-Ezrin (Ab-353) |
100ug |
284 |
|
LF-PA20151 |
anti-Ezrin (Ab-566) |
100ug |
284 |
|
LF-PA20152 |
anti-Ezrin (Phospho-Thr566) |
100ug |
335 |
|
LF-PA20153 |
anti-Ezrin (Phospho-Tyr353) |
100ug |
335 |
|
LF-PA20154 |
anti-FAK (Ab-397) |
100ug |
284 |
|
LF-PA20155 |
anti-FAK (Ab-861) |
100ug |
284 |
|
LF-PA20156 |
anti-FAK (Ab-925) |
100ug |
284 |
|
LF-PA20157 |
anti-FAK (Phospho-Tyr861) |
100ug |
335 |
|
LF-PA20158 |
anti-FAK (Phospho-Tyr925) |
100ug |
335 |
|
LF-PA20159 |
anti-FKHR (Ab-256) |
100ug |
284 |
|
LF-PA20160 |
anti-FKHR (Ab-319) |
100ug |
284 |
|
LF-PA20161 |
anti-FKHR (Phospho-Ser256) |
100ug |
335 |
|
LF-PA20162 |
anti-FKHR (Phospho-Ser319) |
100ug |
335 |
|
LF-PA20163 |
anti-FKHRL1 (Ab-253) |
100ug |
284 |
|
LF-PA20164 |
anti-FKHRL1 (Phospho-Ser253) |
100ug |
335 |
|
LF-PA20166 |
anti-Flag-Tag polyclonal antibody |
100ug |
284 |
|
LF-PA20167 |
anti-G3BP-1 (Ab-232) |
100ug |
284 |
|
LF-PA20168 |
anti-G3BP-1 (Phospho-Ser232) |
100ug |
335 |
|
LF-PA20169 |
anti-Gab1 (Ab-627) |
100ug |
284 |
|
LF-PA20170 |
anti-Gab1 (Phospho-Tyr627) |
100ug |
335 |
|
LF-PA20171 |
anti-GAP43(Ab-41) |
100ug |
284 |
|
LF-MA20172 |
anti-GAPDH |
100ug |
284 |
|
LF-PA20173 |
anti-GAPDH |
100ug |
284 |
|
LF-PA20174 |
anti-GATA1 (Ab-142) |
100ug |
284 |
|
LF-PA20175 |
anti-GATA1 (Ab-310) |
100ug |
284 |
|
LF-PA20176 |
anti-GATA1 (Phospho-Ser142) |
100ug |
335 |
|
LF-PA20177 |
anti-GATA1 (Phospho-Ser310) |
100ug |
335 |
|
LF-PA20179 |
anti-GluR1 (Ab-849) |
100ug |
284 |
|
LF-PA20180 |
anti-GluR1 (phospho-Ser849) |
100ug |
335 |
|
LF-PA20181 |
anti-Glutamate receptor 2 (Precursor) (Ab-880) antibody |
100ug |
284 |
|
LF-PA20182 |
anti-Glutamate receptor 2 (Precursor) (phospho-Ser880) antibody |
100ug |
335 |
|
LF-PA20183 |
anti-GSK3α (Ab-21) |
100ug |
284 |
|
LF-PA20184 |
anti-GSK3α (Phospho-Ser21) |
100ug |
335 |
|
LF-PA20185 |
anti-GSK3β (Ab-216) |
100ug |
284 |
|
LF-PA20186 |
anti-GSK3β (Phospho-Ser9) |
100ug |
335 |
|
LF-PA20187 |
anti-GSK3β (Phospho-Tyr216) |
100ug |
335 |
|
LF-PA20188 |
anti-GSK3β(Ab-9) |
100ug |
284 |
|
LF-PA20189 |
anti-GST-Tag polyclonal antibody |
100ug |
284 |
|
LF-MA20190 |
anti-HA-Tag monoclonal antibody |
100ug |
284 |
|
LF-PA20191 |
anti-HA-Tag polyclonal antibody |
100ug |
284 |
|
LF-PA20192 |
anti-HDAC2 (Ab-394) |
100ug |
284 |
|
LF-PA20193 |
anti-HDAC4 (Ab-632) |
100ug |
284 |
|
LF-PA20194 |
anti-HDAC4 (Phospho-Ser632) |
100ug |
335 |
|
LF-PA20195 |
anti-HDAC5 (Ab-498) |
100ug |
284 |
|
LF-PA20196 |
anti-HDAC5 (Phospho-Ser498) |
100ug |
335 |
|
LF-PA20197 |
anti-HDAC8 (Ab-39) |
100ug |
284 |
|
LF-PA20198 |
anti-HDAC8 (Phospho-Ser39) |
100ug |
335 |
|
LF-PA20199 |
anti-HER2 (Ab-1221/1222) |
100ug |
284 |
|
LF-PA20200 |
anti-HER2 (Ab-1248) |
100ug |
284 |
|
LF-PA20201 |
anti-HER2 (Ab-877) |
100ug |
284 |
|
LF-PA20202 |
anti-HER2 (Phospho-Tyr1221/Tyr1222) |
100ug |
335 |
|
LF-PA20203 |
anti-HER2 (Phospho-Tyr1248) |
100ug |
335 |
|
LF-PA20204 |
anti-HER2 (Phospho-Tyr877) |
100ug |
335 |
|
LF-PA20206 |
anti-His-Tag polyclonal antibody |
100ug |
284 |
|
LF-PA20207 |
anti-Histone H2A.X (Ab-139) |
100ug |
284 |
|
LF-PA20208 |
anti-Histone H2A.X (Phospho-Ser139) |
100ug |
335 |
|
LF-PA20209 |
anti-Histone H3.1 (Ab-10) |
100ug |
284 |
|
LF-PA20210 |
anti-Histone H3.1 (Phospho-Ser10) |
100ug |
335 |
|
LF-PA20211 |
anti-HSF1 (Ab-303) |
100ug |
284 |
|
LF-PA20212 |
anti-HSF1 (Ab-307) |
100ug |
284 |
|
LF-PA20213 |
anti-HSF1 (phospho-Ser303) |
100ug |
335 |
|
LF-PA20214 |
anti-HSP27 (Ab-15) |
100ug |
284 |
|
LF-PA20215 |
anti-HSP27 (Ab-78) |
100ug |
284 |
|
LF-PA20216 |
anti-HSP27 (Ab-82) |
100ug |
284 |
|
LF-PA20217 |
anti-HSP27 (Phospho-Ser15) |
100ug |
335 |
|
LF-PA20218 |
anti-HSP27(Phospho-Ser78) |
100ug |
335 |
|
LF-PA20219 |
anti-HSP27(Phospho-Ser82) |
100ug |
335 |
|
LF-PA20220 |
anti-HSP90B (Ab-254) |
100ug |
284 |
|
LF-PA20221 |
anti-HSP90B (Phospho-Ser254) |
100ug |
335 |
|
LF-PA20222 |
anti-ICAM-1 (Ab-512) |
100ug |
284 |
|
LF-PA20223 |
anti-ICAM-1 (Phospho-Tyr512) |
100ug |
335 |
|
LF-PA20224 |
anti-IGF-1R (Ab-1280) |
100ug |
284 |
|
LF-PA20225 |
anti-IGF-1R (Ab-1346) |
100ug |
284 |
|
LF-PA20226 |
anti-IGF-1R (Ab-1161) |
100ug |
284 |
|
LF-PA20227 |
anti-IGF-1R (Ab-1165/1166) |
100ug |
284 |
|
LF-PA20228 |
anti-IGF-1R (Phospho-Tyr1161) |
100ug |
335 |
|
LF-PA20229 |
anti-IGF-1R (Phospho-Tyr1165/Tyr1166) |
100ug |
335 |
|
LF-PA20230 |
anti-IkB-ε (Ab-22) |
100ug |
284 |
|
LF-PA20231 |
anti-IkB-ε (Phospho-Ser22) |
100ug |
335 |
|
LF-PA20232 |
anti-IKK α (Ab-23) |
100ug |
284 |
|
LF-PA20233 |
anti-IKK α (Phospho-Thr23) |
100ug |
335 |
|
LF-PA20234 |
anti-Integrin β3 (Ab-773) |
100ug |
284 |
|
LF-PA20235 |
anti-Integrin β3 (Phospho-Tyr773) |
100ug |
335 |
|
LF-PA20236 |
anti-Integrin β3 (Phospho-Tyr785) |
100ug |
335 |
|
LF-PA20237 |
anti-IRS-1 (Ab-307) |
100ug |
284 |
|
LF-PA20238 |
anti-IKK α (Phospho-Thr23) |
100ug |
335 |
|
LF-PA20239 |
anti-Integrin β3 (Ab-773) |
100ug |
284 |
|
LF-PA20240 |
anti-Integrin β3 (Ab-785) |
100ug |
284 |
|
LF-PA20241 |
anti-Integrin β3 (Phospho-Tyr773) |
100ug |
335 |
|
LF-PA20242 |
anti-Integrin β3 (Phospho-Tyr785) |
100ug |
335 |
|
LF-PA20243 |
anti-IRS-1 (Ab-307) |
100ug |
284 |
|
LF-PA20244 |
anti-IRS-1 (Ab-312) |
100ug |
284 |
|
LF-PA20245 |
anti-IRS-1 (Ab-636) |
100ug |
284 |
|
LF-PA20246 |
anti-IRS-1 (Ab-639) |
100ug |
284 |
|
LF-PA20247 |
anti-IRS-1 (Phospho-Ser307) |
100ug |
335 |
|
LF-PA20248 |
anti-IRS-1 (Phospho-Ser312) |
100ug |
335 |
|
LF-PA20249 |
anti-IRS-1 (Phospho-Ser636) |
100ug |
335 |
|
LF-PA20250 |
anti-IRS-1 (Phospho-Ser639) |
100ug |
335 |
|
LF-PA20251 |
anti-IκB-α (Ab-32/36) |
100ug |
284 |
|
LF-PA20252 |
anti-IκB-α (Ab-42) |
100ug |
284 |
|
LF-PA20253 |
anti-IκB-α (Phospho-Ser32/Ser36) |
100ug |
335 |
|
LF-PA20254 |
anti-IκB-α (Phospho-Tyr42) |
100ug |
335 |
|
LF-PA20255 |
anti-IκB-β (Ab-23) |
100ug |
284 |
|
LF-PA20256 |
anti-IκB-β (Phospho-Ser23) |
100ug |
335 |
|
LF-PA20257 |
anti-JAK1 (Ab-1022) |
100ug |
284 |
|
LF-PA20258 |
anti-JAK1 (Phospho-Tyr1022) |
100ug |
335 |
|
LF-PA20259 |
anti-JAK2 (Ab-221) |
100ug |
284 |
|
LF-PA20260 |
anti-JAK2 (Phospho-Tyr1007) |
100ug |
335 |
|
LF-PA20261 |
anti-JAK2 (Phospho-Tyr221) |
100ug |
335 |
|
LF-PA20262 |
anti-JunB (Ab-259) |
100ug |
284 |
|
LF-PA20263 |
anti-JunB (Ab-79) |
100ug |
284 |
|
LF-PA20264 |
anti-JunB (Phospho-Ser259) |
100ug |
335 |
|
LF-PA20265 |
anti-JunB (Phospho-Ser79) |
100ug |
335 |
|
LF-PA20266 |
anti-JunD (Ab-255) |
100ug |
284 |
|
LF-PA20267 |
anti-JunD (Phospho-Ser255) |
100ug |
335 |
|
LF-PA20268 |
anti-Keratin 18 (Ab-33) |
100ug |
284 |
|
LF-PA20269 |
anti-Keratin 18 (Ab-73) |
100ug |
284 |
|
LF-PA20270 |
anti-Keratin 18 (Phospho-Ser33) |
100ug |
335 |
|
LF-PA20271 |
anti-LC3A/Apg-8 |
100ug |
284 |
|
LF-PA20272 |
anti-Lck (Phospho-Tyr393) |
100ug |
335 |
|
LF-PA20273 |
anti-LIMK1 (Ab-508) |
100ug |
284 |
|
LF-PA20274 |
anti-LIMK1 (Phospho-Thr508) |
100ug |
335 |
|
LF-PA20275 |
anti-LIMK2 (Ab-505) |
100ug |
284 |
|
LF-PA20276 |
anti-LIMK2 (Phospho-Thr505) |
100ug |
335 |
|
LF-PA20277 |
anti-MAPKAPK-2 (Ab-334) |
100ug |
284 |
|
LF-PA20278 |
anti-MAPKAPK-2 (Phospho-Thr334) |
100ug |
335 |
|
LF-PA20279 |
anti-MARCKS (Ab-158) |
100ug |
284 |
|
LF-PA20280 |
anti-MARCKS (Ab-162) |
100ug |
284 |
|
LF-PA20281 |
anti-MARCKS (Phospho-Ser158) |
100ug |
335 |
|
LF-PA20282 |
anti-MEF2A (Ab-312) |
100ug |
284 |
|
LF-PA20283 |
anti-MEF2A (Ab-319) |
100ug |
284 |
|
LF-PA20284 |
anti-MEF2A (Phospho-Ser408) |
100ug |
335 |
|
LF-PA20285 |
anti-MEF2A (Phospho-Thr312) |
100ug |
335 |
|
LF-PA20286 |
anti-MEK1 (Ab-217) |
100ug |
284 |
|
LF-PA20287 |
anti-MEK1 (Ab-221) |
100ug |
284 |
|
LF-PA20288 |
anti-MEK1 (Ab-291) |
100ug |
284 |
|
LF-PA20289 |
anti-MEK1 (Phospho-Ser217) |
100ug |
335 |
|
LF-PA20290 |
anti-MEK1 (Phospho-Ser221) |
100ug |
335 |
|
LF-PA20291 |
anti-MEK1 (Phospho-Thr291) |
100ug |
335 |
|
LF-PA20292 |
anti-MEK-2 (Ab-394) |
100ug |
284 |
|
LF-PA20293 |
anti-MEK-2 (Phospho-Thr394) |
100ug |
335 |
|
LF-PA20294 |
anti-Merlin (Ab-518) |
100ug |
284 |
|
LF-PA20295 |
anti-Merlin (Phospho-Ser518) |
100ug |
335 |
|
LF-PA20296 |
anti-Met (Ab-1234) |
100ug |
284 |
|
LF-PA20297 |
anti-Met (Ab-1349) |
100ug |
284 |
|
LF-PA20298 |
anti-Met (Phospho-Tyr1234) |
100ug |
335 |
|
LF-PA20299 |
anti-Met (Phospho-Tyr1349) |
100ug |
335 |
|
LF-PA20300 |
anti-MKK3 (Ab-189) |
100ug |
284 |
|
LF-PA20301 |
anti-MKK3 (Phospho-Ser189) |
100ug |
335 |
|
LF-PA20302 |
anti-MKK6 (Ab-207) |
100ug |
284 |
|
LF-PA20303 |
anti-MKK6 (Phospho-Ser207) |
100ug |
335 |
|
LF-PA20304 |
anti-MSK1 (Ab-376) |
100ug |
284 |
|
LF-PA20305 |
anti-mTOR (Phospho-Ser2448) |
100ug |
335 |
|
LF-PA20306 |
anti-Myc (Ab-358) |
100ug |
284 |
|
LF-PA20307 |
anti-Myc (Ab-373) |
100ug |
284 |
|
LF-PA20308 |
anti-Myc (Ab-58) |
100ug |
284 |
|
LF-PA20309 |
anti-Myc (Phospho-Ser373) |
100ug |
335 |
|
LF-PA20310 |
anti-Myc (Phospho-Thr358) |
100ug |
335 |
|
LF-PA20311 |
anti-Myc (Phospho-Thr58) |
100ug |
335 |
|
LF-PA20313 |
anti-MyoD (Ab-200) |
100ug |
284 |
|
LF-PA20314 |
anti-MyoD (Phospho-Ser200) |
100ug |
335 |
|
LF-PA20315 |
anti-Myosin Light Chain 2 (Ab-18) |
100ug |
284 |
|
LF-PA20316 |
anti-NFκB -p65 (Ab-435) |
100ug |
284 |
|
LF-PA20317 |
anti-NFκB-p100/p52 (Ab-865) |
100ug |
284 |
|
LF-PA20318 |
anti-NFκB-p100/p52 (Ab-869) |
100ug |
284 |
|
LF-PA20319 |
anti-NFκB-p100/p52 (Ab-871) |
100ug |
284 |
|
LF-PA20320 |
anti-NFκB-p100/p52 (Phospho-Ser865) |
100ug |
335 |
|
LF-PA20321 |
anti-NFκB-p100/p52 (Phospho-Ser869) |
100ug |
335 |
|
LF-PA20322 |
anti-NFκB-p105/p50 (Ab-337) |
100ug |
284 |
|
LF-PA20323 |
anti-NFκB-p105/p50 (Ab-893) |
100ug |
284 |
|
LF-PA20324 |
anti-NFκB-p105/p50 (Ab-907) |
100ug |
284 |
|
LF-PA20325 |
anti-NFκB-p105/p50 (Ab-927) |
100ug |
284 |
|
LF-PA20326 |
anti-NFκB-p105/p50 (Ab-932) |
100ug |
284 |
|
LF-PA20327 |
anti-NFκB-p105/p50 (Phospho-Se927) |
100ug |
335 |
|
LF-PA20328 |
anti-NFκB-p105/p50 (Phospho-Ser337) |
100ug |
335 |
|
LF-PA20329 |
anti-NFκB-p105/p50 (Phospho-Ser893) |
100ug |
335 |
|
LF-PA20330 |
anti-NFκB-p105/p50 (Phospho-Ser907) |
100ug |
335 |
|
LF-PA20331 |
anti-NFκB-p105/p50(Phospho-Ser932) |
100ug |
335 |
|
LF-PA20332 |
anti-NFκB-p65 (Ab-254) |
100ug |
284 |
|
LF-PA20333 |
anti-NFκB-p65 (Ab-276) |
100ug |
284 |
|
LF-PA20334 |
anti-NFκB-p65 (Ab-311) |
100ug |
284 |
|
LF-PA20335 |
anti-NFκB-p65 (Ab-468) |
100ug |
284 |
|
LF-PA20336 |
anti-NFκB-p65 (Ab-529) |
100ug |
284 |
|
LF-PA20337 |
anti-NFκB-p65 (Ab-536) |
100ug |
284 |
|
LF-PA20338 |
anti-NFκB-p65 (Phospho-Ser276) |
100ug |
335 |
|
LF-PA20339 |
anti-NFκB-p65 (phospho-Ser311) |
100ug |
335 |
|
LF-PA20340 |
anti-NFκB-p65 (Phospho-Ser468) |
100ug |
335 |
|
LF-PA20341 |
anti-NFκB-p65 (Phospho-Ser529) |
100ug |
335 |
|
LF-PA20342 |
anti-NFκB-p65 (Phospho-Ser536) |
100ug |
335 |
|
LF-PA20343 |
anti-NFκB-p65 (Phospho-Thr254) |
100ug |
335 |
|
LF-PA20344 |
anti-NFκB-p65 (Phospho-Thr435) |
100ug |
335 |
|
LF-PA20345 |
anti-Niban |
100ug |
284 |
|
LF-PA20346 |
anti-Niban-like protein 1 (Ab-712) antibody |
100ug |
284 |
|
LF-PA20347 |
anti-NMDAR1 (Ab-896) |
100ug |
284 |
|
LF-PA20348 |
anti-NMDAR1 (Phospho-Ser896) |
100ug |
335 |
|
LF-PA20349 |
anti-p27Kip1 (Ab-10) |
100ug |
284 |
|
LF-PA20350 |
anti-p27Kip1 (Phospho-Thr187) |
100ug |
335 |
|
LF-PA20351 |
anti-p38 MAPK (Ab-182) |
100ug |
284 |
|
LF-PA20352 |
anti-p38 MAPK (Phospho-Thr180) |
100ug |
335 |
|
LF-PA20353 |
anti-p38 MAPK (Phospho-Tyr182) |
100ug |
335 |
|
LF-PA20354 |
anti-p44/42 MAP Kinase (Ab-202) |
100ug |
284 |
|
LF-PA20355 |
anti-p44/42 MAP Kinase (Ab-204) |
100ug |
284 |
|
LF-PA20356 |
anti-p44/42 MAP Kinase (Phospho-Thr202) |
100ug |
335 |
|
LF-PA20357 |
anti-p44/42 MAP Kinase (Phospho-Tyr204) |
100ug |
335 |
|
LF-PA20358 |
anti-p53 (Ab-15) |
100ug |
284 |
|
LF-PA20359 |
anti-p53 (Ab-315) |
100ug |
284 |
|
LF-PA20360 |
anti-p53 (Ab-46) |
100ug |
284 |
|
LF-PA20361 |
anti-p53 (Phospho-Ser15) |
100ug |
335 |
|
LF-PA20362 |
anti-p53 (Phospho-Ser315) |
100ug |
335 |
|
LF-PA20363 |
anti-p53 (Phospho-Ser46) |
100ug |
335 |
|
LF-PA20364 |
anti-p56Dok-2 (Ab-299) |
100ug |
284 |
|
LF-PA20365 |
anti-p56Dok-2 (Phospho-Tyr299) |
100ug |
335 |
|
LF-PA20366 |
anti-p62Dok (Ab-362) |
100ug |
284 |
|
LF-PA20367 |
anti-p62Dok (Ab-398) |
100ug |
284 |
|
LF-PA20368 |
anti-p62Dok (phospho-Tyr362) |
100ug |
335 |
|
LF-PA20369 |
anti-p62Dok (phospho-Tyr398) |
100ug |
335 |
|
LF-PA20370 |
anti-p70 S6 Kinase (Ab-424) |
100ug |
284 |
|
LF-PA20371 |
anti-p70 S6 Kinase (Phospho-Ser424) |
100ug |
335 |
|
LF-PA20372 |
anti-p70 S6 Kinase (Ab-389) |
100ug |
284 |
|
LF-PA20373 |
anti-p70 S6 Kinase (Ab-411) |
100ug |
284 |
|
LF-PA20374 |
anti-p70 S6 Kinase (Ab-421) |
100ug |
284 |
|
LF-PA20375 |
anti-p70 S6 Kinase (Phospho-Ser411) |
100ug |
335 |
|
LF-PA20376 |
anti-p70 S6 Kinase (Phospho-Thr421) |
100ug |
335 |
|
LF-PA20377 |
anti-p73 (Ab-99) |
100ug |
284 |
|
LF-PA20378 |
anti-p73 (Phospho-Tyr99) |
100ug |
335 |
|
LF-PA20379 |
anti-p90RSK (Ab-348) |
100ug |
284 |
|
LF-PA20380 |
anti-p90RSK (Ab-352) |
100ug |
284 |
|
LF-PA20381 |
anti-p90RSK (Phospho-Thr348) |
100ug |
335 |
|
LF-PA20382 |
anti-p95/NBS1 (Ab-343) |
100ug |
284 |
|
LF-PA20383 |
anti-p95/NBS1 (Phospho-Ser343) |
100ug |
335 |
|
LF-PA20384 |
anti-PAK1 (Ab-212) |
100ug |
284 |
|
LF-PA20385 |
anti-PAK1 (Phospho-Thr212) |
100ug |
284 |
|
LF-PA20386 |
anti-PAK1/PAK2/PAK3 (Ab-423/402/421) |
100ug |
284 |
|
LF-PA20387 |
anti-PAK1/PAK2/PAK3 (Phospho-Thr423/Thr402/Thr421) |
100ug |
335 |
|
LF-PA20388 |
anti-Paxillin (Ab-118) |
100ug |
284 |
|
LF-PA20389 |
anti-Paxillin (Ab-31) |
100ug |
284 |
|
LF-PA20390 |
anti-Paxillin (Phospho-Tyr118) |
100ug |
335 |
|
LF-PA20391 |
anti-Paxillin (Phospho-Tyr31) |
100ug |
335 |
|
LF-PA20392 |
anti-PDGF Receptor β (Ab-752) |
100ug |
284 |
|
LF-PA20393 |
anti-PDK1 (Ab-241) |
100ug |
284 |
|
LF-PA20394 |
anti-PDK1 (Phospho-Ser241) |
100ug |
335 |
|
LF-PA20395 |
anti-PKCβ (Ab-642) |
100ug |
284 |
|
LF-PA20396 |
anti-PKCβ (Phospho-Thr642) |
100ug |
335 |
|
LF-PA20397 |
anti-PKCδ (Ab-645) |
100ug |
284 |
|
LF-PA20398 |
anti-PKCδ (Phospho-Ser645) |
100ug |
335 |
|
LF-PA20399 |
anti-PKCζ (Ab-1427) |
100ug |
284 |
|
LF-PA20400 |
anti-PKCζ (Phospho-Thr410) |
100ug |
335 |
|
LF-PA20401 |
anti-PKCθ (Ab-676) |
100ug |
284 |
|
LF-PA20402 |
anti-PKCθ (Ab-695) |
100ug |
284 |
|
LF-PA20403 |
anti-PKCθ (Phospho-Ser676) |
100ug |
335 |
|
LF-PA20404 |
anti-PKCθ (Phospho-Ser695) |
100ug |
335 |
|
LF-PA20405 |
anti-PKD/PKCμ (Ab-738) |
100ug |
284 |
|
LF-PA20406 |
anti-PKD/PKCμ (Ab-910) |
100ug |
284 |
|
LF-PA20407 |
anti-PKD/PKCμ (Phospho-Ser738) |
100ug |
335 |
|
LF-PA20408 |
anti-PKD/PKCμ (Phospho-Ser910) |
100ug |
335 |
|
LF-PA20409 |
anti-PKR (Ab-446) |
100ug |
284 |
|
LF-PA20410 |
anti-PKR (Ab-451) |
100ug |
284 |
|
LF-PA20411 |
anti-PKR (Phospho-Thr446) |
100ug |
335 |
|
LF-PA20412 |
anti-PKR (Phospho-Thr451) |
100ug |
335 |
|
LF-PA20413 |
anti-PLCγ1 (Ab-783) |
100ug |
284 |
|
LF-PA20414 |
anti-PLCγ1 (Phospho-Tyr783) |
100ug |
335 |
|
LF-PA20415 |
anti-PLCγ2 (Ab-753) |
100ug |
284 |
|
LF-PA20416 |
anti-PLCγ2 (Phospho-Tyr753) |
100ug |
335 |
|
LF-PA20417 |
anti-Progesterone Receptor (Ab-190) |
100ug |
284 |
|
LF-PA20418 |
anti-Progesterone Receptor (Phospho-Ser190) |
100ug |
335 |
|
LF-PA20419 |
anti-PTEN (Ab-370) |
100ug |
284 |
|
LF-PA20420 |
anti-PTEN (Ab-380/382/383) |
100ug |
284 |
|
LF-PA20421 |
anti-PTEN (Phospho-Ser370) |
100ug |
335 |
|
LF-PA20422 |
anti-PTEN (Phospho-Ser380) |
100ug |
335 |
|
LF-PA20423 |
anti-PTEN (Phospho-Ser380/Thr382/Thr383) |
100ug |
335 |
|
LF-PA20424 |
anti-Pyk2 (Ab-402) |
100ug |
284 |
|
LF-PA20425 |
anti-Pyk2 (Phospho-Tyr402) |
100ug |
335 |
|
LF-PA20426 |
anti-Rac1 (Ab-71) |
100ug |
284 |
|
LF-PA20427 |
anti-Rac1 ((Phospho-Ser71) |
100ug |
335 |
|
LF-PA20428 |
anti-Raf1 (Ab-259) |
100ug |
284 |
|
LF-PA20429 |
anti-Raf1 (Phospho-Ser259) |
100ug |
335 |
|
LF-PA20430 |
anti-Rb (Ab-780) |
100ug |
284 |
|
LF-PA20431 |
anti-Rb (Ab-795) |
100ug |
284 |
|
LF-PA20432 |
anti-Rb (Ab-807) |
100ug |
284 |
|
LF-PA20433 |
anti-Rb (Phospho-Ser780) |
100ug |
335 |
|
LF-PA20434 |
anti-Rb (Phospho-Ser795) |
100ug |
335 |
|
LF-PA20435 |
anti-Rb (Phospho-Ser807) |
100ug |
335 |
|
LF-PA20436 |
anti-RelB (Ab-552) |
100ug |
284 |
|
LF-PA20437 |
anti-RelB (Phospho-Ser552) |
100ug |
335 |
|
LF-PA20438 |
anti-S6 Ribosomal Protein (Ab-235) |
100ug |
284 |
|
LF-PA20439 |
anti-S6 Ribosomal Protein (Phospho-Ser235) |
100ug |
335 |
|
LF-PA20440 |
anti-SAPK/JNK2/3 (Ab-183) |
100ug |
284 |
|
LF-PA20441 |
anti-SAPK/JNK2/3 (Ab-185) |
100ug |
284 |
|
LF-PA20442 |
anti-SAPK/JNK2/3 (Phospho-Thr183) |
100ug |
335 |
|
LF-PA20443 |
anti-SEK1/MKK4 (Ab-261) |
100ug |
284 |
|
LF-PA20444 |
anti-SEK1/MKK4 (Ab-80) |
100ug |
284 |
|
LF-PA20445 |
anti-SEK1/MKK4 (Phospho-Ser80) |
100ug |
335 |
|
LF-PA20446 |
anti-SEK1/MKK4 (Phospho-Thr261) |
100ug |
335 |
|
LF-PA20447 |
anti-Shc1 (Ab-349) |
100ug |
284 |
|
LF-PA20448 |
anti-Shc1 (Ab-427) |
100ug |
284 |
|
LF-PA20449 |
anti-Shc1 (Phospho-Tyr349) |
100ug |
335 |
|
LF-PA20450 |
anti-Shc1 (Phospho-Tyr427) |
100ug |
335 |
|
LF-PA20451 |
anti-SHP-1 (Ab-536) |
100ug |
284 |
|
LF-PA20452 |
anti-SHP-1 (Phospho-Tyr536) |
100ug |
335 |
|
LF-PA20453 |
anti-SHP-2 (Ab-542) |
100ug |
284 |
|
LF-PA20454 |
anti-SHP-2 (Ab-580) |
100ug |
284 |
|
LF-PA20455 |
anti-SHP-2 (Phospho-Tyr542) |
100ug |
335 |
|
LF-PA20456 |
anti-SHP-2 (Phospho-Tyr580) |
100ug |
335 |
|
LF-PA20457 |
anti-Smad1 (Ab-465) |
100ug |
284 |
|
LF-PA20458 |
anti-Smad1 (Phospho-Ser465) |
100ug |
335 |
|
LF-PA20459 |
anti-Smad2 (Ab-467) |
100ug |
284 |
|
LF-PA20460 |
anti-Smad2 (Phospho-Ser467) |
100ug |
335 |
|
LF-PA20461 |
anti-SMC1 (Ab-957) |
100ug |
284 |
|
LF-PA20462 |
anti-SMC1 (Phospho-Ser957) |
100ug |
335 |
|
LF-PA20463 |
anti-Src (Ab-418) |
100ug |
284 |
|
LF-PA20464 |
anti-Src (Ab-529) |
100ug |
284 |
|
LF-PA20465 |
anti-Src (Phospho-Tyr418) |
100ug |
335 |
|
LF-PA20466 |
anti-Src (Phospho-Tyr529) |
100ug |
335 |
|
LF-PA20467 |
anti-STAT1 (Ab-701) |
100ug |
284 |
|
LF-PA20468 |
anti-STAT1 (Ab-727) |
100ug |
284 |
|
LF-PA20469 |
anti-STAT1 (Phospho-Ser727) |
100ug |
335 |
|
LF-PA20470 |
anti-STAT1 (Phospho-Tyr701) |
100ug |
335 |
|
LF-PA20471 |
anti-STAT3 (Ab-705) |
100ug |
284 |
|
LF-PA20472 |
anti-STAT3 (Ab-727) |
100ug |
284 |
|
LF-PA20473 |
anti-STAT3 (Phospho-Ser727) |
100ug |
335 |
|
LF-PA20474 |
anti-STAT3 (Phospho-Tyr705) |
100ug |
335 |
|
LF-PA20475 |
anti-STAT4 (Ab-693) |
100ug |
284 |
|
LF-PA20476 |
anti-STAT4 (Phospho-Tyr693) |
100ug |
335 |
|
LF-PA20477 |
anti-STAT5A (Ab-694) |
100ug |
284 |
|
LF-PA20478 |
anti-STAT5A (Ab-780) |
100ug |
284 |
|
LF-PA20479 |
anti-STAT5A (Phospho-Ser780) |
100ug |
335 |
|
LF-PA20480 |
anti-STAT5A (Phospho-Tyr694) |
100ug |
335 |
|
LF-PA20481 |
anti-STAT6 (Ab-641) |
100ug |
284 |
|
LF-PA20482 |
anti-STAT6 (Ab-645) |
100ug |
284 |
|
LF-PA20483 |
anti-STAT6 (Phospho-Thr645) |
100ug |
335 |
|
LF-PA20484 |
anti-STAT6 (Phospho-Tyr641) |
100ug |
335 |
|
LF-PA20485 |
anti-Stathmin 1 (Ab-15) |
100ug |
284 |
|
LF-PA20486 |
anti-Stathmin 1 (Ab-24) |
100ug |
284 |
|
LF-PA20487 |
anti-Stathmin 1 (Ab-37) |
100ug |
284 |
|
LF-PA20488 |
anti-Stathmin 1 (Phospho-Ser15) |
100ug |
335 |
|
LF-PA20489 |
anti-Stathmin 1 (Phospho-Ser24) |
100ug |
335 |
|
LF-PA20490 |
anti-Stathmin 1 (Phospho-Ser37) |
100ug |
335 |
|
LF-PA20491 |
anti-synapsin (Ab-9) |
100ug |
284 |
|
LF-PA20492 |
anti-synapsin (Phospho-Ser9) |
100ug |
335 |
|
LF-PA20493 |
anti-Synuclein (Ab-125) |
100ug |
284 |
|
LF-PA20494 |
anti-Synuclein (Ab-136) |
100ug |
284 |
|
LF-PA20495 |
anti-Tau (Ab-181) |
100ug |
284 |
|
LF-PA20496 |
anti-Tau (Ab-205) |
100ug |
284 |
|
LF-PA20497 |
anti-Tau (Ab-212) |
100ug |
284 |
|
LF-PA20498 |
anti-Tau (Ab-231) |
100ug |
284 |
|
LF-PA20499 |
anti-Tau (Ab-235) |
100ug |
284 |
|
LF-PA20500 |
anti-Tau (Ab-262) |
100ug |
284 |
|
LF-PA20501 |
anti-Tau (Ab-396) |
100ug |
284 |
|
LF-PA20502 |
anti-Tau (Ab-404) |
100ug |
284 |
|
LF-PA20503 |
anti-Tau (Ab-422) |
100ug |
284 |
|
LF-PA20504 |
anti-Tau (Phospho-Ser214) |
100ug |
335 |
|
LF-PA20505 |
anti-Tau (Phospho-Ser235) |
100ug |
335 |
|
LF-PA20506 |
anti-Tau (Phospho-Ser262) |
100ug |
335 |
|
LF-PA20507 |
anti-Tau (Phospho-Ser356) |
100ug |
335 |
|
LF-PA20508 |
anti-Tau (Phospho-Ser396) |
100ug |
335 |
|
LF-PA20509 |
anti-Tau (Phospho-Ser404) |
100ug |
335 |
|
LF-PA20510 |
anti-Tau (Phospho-Thr181) |
100ug |
335 |
|
LF-PA20511 |
anti-Tau (Phospho-Thr205) |
100ug |
335 |
|
LF-PA20512 |
anti-Tau (Phospho-Thr212) |
100ug |
335 |
|
LF-PA20513 |
anti-Tau (Phospho-Thr231) |
100ug |
335 |
|
LF-PA20514 |
anti-TYK2 (Ab-1054) |
100ug |
284 |
|
LF-PA20515 |
anti-V5-Tag polyclonal antibody |
100ug |
284 |
|
LF-PA20516 |
anti-VASP (Ab-157) |
100ug |
284 |
|
LF-PA20517 |
anti-VASP (Ab-238) |
100ug |
284 |
|
LF-PA20518 |
anti-VASP (Phospho-Ser157) |
100ug |
335 |
|
LF-PA20519 |
anti-VASP (Phospho-Ser238) |
100ug |
335 |
|
LF-PA20520 |
anti-Vav (Ab-174) |
100ug |
284 |
|
LF-PA20521 |
anti-Vav (Phospho-Tyr174) |
100ug |
335 |
|
LF-PA20522 |
anti-VEGFR2 (Ab-1175) |
100ug |
284 |
|
LF-PA20523 |
anti-VEGFR2 (Ab-1214) |
100ug |
284 |
|
LF-PA20524 |
anti-VEGFR2 (Ab-951) |
100ug |
284 |
|
LF-PA20525 |
anti-VEGFR2 (Phospho-Tyr1175) |
100ug |
335 |
|
LF-PA20526 |
anti-VEGFR2 (Phospho-Tyr1214) |
100ug |
335 |
|
LF-PA20527 |
anti-VEGFR2 (Phospho-Tyr951) |
100ug |
335 |
|
LF-PA20528 |
anti-ZAP70 (Ab-319) |
100ug |
284 |
|
LF-PA20529 |
anti-ZAP70 (Ab-493) |
100ug |
284 |
|
LF-PA20530 |
anti-ZAP70 (Phospho-Tyr319) |
100ug |
335 |
|
LF-PA20531 |
anti-ZAP70 (Phospho-Tyr493) |
100ug |
335 |
|
LF-PA20532 |
anti-α-catenin (Ab-641) antibody |
100ug |
284 |
|
LF-PA20533 |
anti-α-catenin (Phospho-Ser641) antibody |
100ug |
335 |
|
LF-PA20534 |
anti-β-Catenin (Ab-33) |
100ug |
284 |
|
LF-PA20535 |
anti-β-Catenin (Ab-37) |
100ug |
284 |
|
LF-PA20536 |
anti-β-Catenin (Ab-41/45) |
100ug |
284 |
|
LF-PA20537 |
anti-β-Catenin (Phospho-Ser33) |
100ug |
335 |
|
LF-PA20538 |
anti-β-Catenin (Phospho-Ser37) |
100ug |
335 |
|
LF-PA20539 |
anti-β-Catenin (Phospho-Thr41/Ser45) |
100ug |
335 |